| MolName | 4-bromo-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| MolecularFormula | C18H12N3O4Br |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\NC(c(cc2)ccc2Br)=O)o1)=O |
| InChI | InChI=1S/C18H12BrN3O4/c19-14-5-1-13(2-6-14)18(23)21-20-11-16-9-10-17(26-16)12-3-7-15(8-4-12)22(24)25/h1-11H,(H,21,23) |
| InChIK | YXHBFTHZDGPOGT-UHFFFAOYSA-N |
| TotalMolweight | 414.214 |
| Molweight | 414.214 |
| MonoisotopicMass | 413.001118 |
| CLogP | 3.9441 |
| CLogS | -6.475 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 278.74 |
| Relative PSA | 0.28894 |
| PolarSurfaceArea | 100.42 |
| Druglikeness | -0.40999 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-bromo-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide | 2 - 4-bromo-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide