| MolName | N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
| MolecularFormula | C9H8N6O4 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(Cn2ncnc2)=O)o1)=O |
| InChI | InChI=1S/C9H8N6O4/c16-8(4-14-6-10-5-12-14)13-11-3-7-1-2-9(19-7)15(17)18/h1-3,5-6H,4H2,(H,13,16) |
| InChIK | ZMRNITMSGJYDCO-UHFFFAOYSA-N |
| TotalMolweight | 264.201 |
| Molweight | 264.201 |
| MonoisotopicMass | 264.060704 |
| CLogP | -0.7467 |
| CLogS | -2.999 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 200.83 |
| Relative PSA | 0.54449 |
| PolarSurfaceArea | 131.13 |
| Druglikeness | 4.7201 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide | 2 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide